CymitQuimica logo

CAS 733742-76-2

:

(1R,2R)-2-(2-ethylbenzoyl)cyclohexane-1-carboxylic acid

Description:
(1R,2R)-2-(2-ethylbenzoyl)cyclohexane-1-carboxylic acid is a chiral compound characterized by its cyclohexane ring structure, which is substituted at the 1 and 2 positions. The presence of the 2-ethylbenzoyl group introduces aromatic characteristics, contributing to its potential reactivity and interactions. This compound features a carboxylic acid functional group, which imparts acidic properties and can participate in hydrogen bonding, influencing its solubility and reactivity in various solvents. The specific stereochemistry indicated by the (1R,2R) designation suggests that it has distinct spatial arrangements, which can affect its biological activity and interactions with other molecules. Such compounds are often of interest in pharmaceutical chemistry due to their potential applications in drug development, where stereochemistry plays a crucial role in efficacy and safety. Additionally, the presence of both aliphatic and aromatic components may provide unique properties, making it suitable for various chemical reactions and applications in organic synthesis.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-2-11-7-3-4-8-12(11)15(17)13-9-5-6-10-14(13)16(18)19/h3-4,7-8,13-14H,2,5-6,9-10H2,1H3,(H,18,19)/t13-,14-/m1/s1
SMILES:CCc1ccccc1C(=O)[C@@H]1CCCC[C@H]1C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.