CAS 733742-77-3

(1R,2R)-2-(4-ethylbenzoyl)cyclohexane-1-carboxylic acid

Description:

(1R,2R)-2-(4-ethylbenzoyl)cyclohexane-1-carboxylic acid is a chiral compound characterized by its cyclohexane ring structure, which is substituted with a carboxylic acid group and a 4-ethylbenzoyl moiety. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The specific stereochemistry indicated by the (1R,2R) configuration suggests that this compound can exhibit unique biological activity and interactions due to its three-dimensional shape. The ethylbenzoyl substituent contributes to the compound's hydrophobic characteristics, potentially influencing its solubility and reactivity in organic solvents. Additionally, the compound's molecular structure may allow for specific interactions with biological targets, making it of interest in pharmaceutical research. Overall, this compound's unique structural features and stereochemistry make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-2-11-7-9-12(10-8-11)15(17)13-5-3-4-6-14(13)16(18)19/h7-10,13-14H,2-6H2,1H3,(H,18,19)/t13-,14-/m1/s1

SMILES: CCc1ccc(cc1)C(=O)[C@@H]1CCCC[C@H]1C(=O)O