CAS 733742-82-0
:(1R,2R)-2-(2,5-dimethylbenzoyl)cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,2R)-2-(2,5-dimethylbenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 733742-82-0, is a chiral compound characterized by its cyclohexane backbone and a carboxylic acid functional group. This compound features a dimethylbenzoyl substituent, which contributes to its unique structural and stereochemical properties. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The specific stereochemistry, denoted by the (1R,2R) configuration, suggests that the compound may exhibit distinct biological activity or reactivity compared to its stereoisomers. Additionally, the presence of the aromatic dimethylbenzoyl group may enhance its hydrophobic characteristics, influencing its interactions in various chemical environments. Overall, this compound's structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research into its properties and reactivity.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-10-7-8-11(2)14(9-10)15(17)12-5-3-4-6-13(12)16(18)19/h7-9,12-13H,3-6H2,1-2H3,(H,18,19)/t12-,13-/m1/s1
SMILES:Cc1ccc(C)c(c1)C(=O)[C@@H]1CCCC[C@H]1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.