CAS 733742-83-1
:(1R,2R)-2-(2,6-dimethylbenzoyl)cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,2R)-2-(2,6-dimethylbenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 733742-83-1, is a chiral compound characterized by its cyclohexane ring structure substituted with a carboxylic acid group and a benzoyl moiety. This compound exhibits specific stereochemistry, indicated by the (1R,2R) configuration, which influences its physical and chemical properties, including solubility, reactivity, and biological activity. The presence of the 2,6-dimethylbenzoyl group contributes to its hydrophobic characteristics, potentially affecting its interaction with biological systems and its application in pharmaceuticals or organic synthesis. As a carboxylic acid, it can participate in acid-base reactions and may form esters or amides under appropriate conditions. The compound's unique structure and stereochemistry make it of interest in various fields, including medicinal chemistry and materials science, where its properties can be exploited for specific applications.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-10-6-5-7-11(2)14(10)15(17)12-8-3-4-9-13(12)16(18)19/h5-7,12-13H,3-4,8-9H2,1-2H3,(H,18,19)/t12-,13-/m1/s1
SMILES:Cc1cccc(C)c1C(=O)[C@@H]1CCCC[C@H]1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.