CAS 733742-85-3
:(1R,2R)-2-(3,5-dimethylbenzoyl)cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,2R)-2-(3,5-dimethylbenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 733742-85-3, is a chiral compound characterized by its cyclohexane backbone and a carboxylic acid functional group. This compound features a dimethylbenzoyl substituent at the 2-position of the cyclohexane ring, which contributes to its unique structural and stereochemical properties. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. Its chirality suggests that it may have distinct biological activities or interactions, making it of interest in pharmaceutical applications. The compound's molecular structure allows for potential interactions with various biological targets, which could be explored in drug development. Additionally, the presence of the dimethylbenzoyl moiety may influence its physical properties, such as melting point and boiling point, as well as its reactivity and stability under different conditions. Overall, this compound represents a significant interest in organic and medicinal chemistry.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-10-7-11(2)9-12(8-10)15(17)13-5-3-4-6-14(13)16(18)19/h7-9,13-14H,3-6H2,1-2H3,(H,18,19)/t13-,14-/m1/s1
SMILES:Cc1cc(C)cc(c1)C(=O)[C@@H]1CCCC[C@H]1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.