CymitQuimica logo

CAS 733757-82-9

:

3-(4-fluorophenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine hydrochloride

Description:
3-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine hydrochloride is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrazole and a pyridine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the hydrochloride salt form. The fluorophenyl group contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various pharmacological properties, including effects on the central nervous system, owing to its structural features that allow for interaction with specific biological targets. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C12H13ClFN3
InChI:InChI=1/C12H12FN3.ClH/c13-9-3-1-8(2-4-9)12-10-7-14-6-5-11(10)15-16-12;/h1-4,14H,5-7H2,(H,15,16);1H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.