
CAS 733776-42-6
:6-(2-Naphthalenyl)-3-pyridinecarboxylic acid
Description:
6-(2-Naphthalenyl)-3-pyridinecarboxylic acid, identified by its CAS number 733776-42-6, is an organic compound characterized by the presence of both a pyridine and a naphthalene moiety. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential for hydrogen bonding. The naphthalene ring system provides a hydrophobic character, while the pyridine ring introduces basicity due to the nitrogen atom, influencing its reactivity and solubility in various solvents. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a ligand in coordination chemistry. Additionally, the presence of both aromatic systems may lead to interesting electronic properties, which could be explored in materials science. Overall, 6-(2-Naphthalenyl)-3-pyridinecarboxylic acid is a versatile compound with potential applications across various fields of chemistry.
Formula:C16H11NO2
InChI:InChI=1S/C16H11NO2/c18-16(19)14-7-8-15(17-10-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-10H,(H,18,19)
InChI key:InChIKey=PCRZTIAUVCOQSW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(C2=CC3=C(C=C2)C=CC=C3)N=C1
Synonyms:- 3-Pyridinecarboxylic acid, 6-(2-naphthalenyl)-
- 6-(2-Naphthalenyl)-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.