
CAS 733776-51-7
:6-(4-Acetylphenyl)-3-pyridinecarboxylic acid
Description:
6-(4-Acetylphenyl)-3-pyridinecarboxylic acid, with the CAS number 733776-51-7, is an organic compound characterized by its pyridine and aromatic acetophenone moieties. This compound features a pyridine ring substituted at the 3-position with a carboxylic acid group and at the 6-position with a 4-acetylphenyl group. The presence of the carboxylic acid functional group imparts acidic properties, allowing for potential interactions in various chemical environments, such as hydrogen bonding and coordination with metal ions. The acetylphenyl group contributes to the compound's hydrophobic characteristics and may influence its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Overall, 6-(4-Acetylphenyl)-3-pyridinecarboxylic acid is a versatile compound with potential utility in various chemical and pharmaceutical contexts.
Formula:C14H11NO3
InChI:InChI=1S/C14H11NO3/c1-9(16)10-2-4-11(5-3-10)13-7-6-12(8-15-13)14(17)18/h2-8H,1H3,(H,17,18)
InChI key:InChIKey=QRSOWOWBCKPGMF-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC=C(C=C1)C2=CC=C(C(O)=O)C=N2
Synonyms:- 3-Pyridinecarboxylic acid, 6-(4-acetylphenyl)-
- 6-(4-Acetylphenyl)-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.