CAS 733796-12-8

2-Chloro-N-[4-(2,4,5-trimethylphenyl)-2-thiazolyl]acetamide

Description:

2-Chloro-N-[4-(2,4,5-trimethylphenyl)-2-thiazolyl]acetamide is a chemical compound characterized by its unique structural features, which include a chloro group and a thiazole ring. The presence of the thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The compound's acetamide functional group suggests it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and reactivity. The trimethylphenyl substituent indicates a bulky aromatic structure that may affect the compound's steric properties and interactions with biological targets. This compound is likely to be of interest in medicinal chemistry and material science due to its potential applications. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups.

Formula: C₁₄H₁₅ClN₂OS

InChI: InChI=1S/C14H15ClN2OS/c1-8-4-10(3)11(5-9(8)2)12-7-19-14(16-12)17-13(18)6-15/h4-5,7H,6H2,1-3H3,(H,16,17,18)

InChI key: InChIKey=RBCDTBSGJJSPCC-UHFFFAOYSA-N

SMILES: CC1=C(C=2N=C(NC(CCl)=O)SC2)C=C(C)C(C)=C1

Synonyms:

• Acetamide, 2-chloro-N-[4-(2,4,5-trimethylphenyl)-2-thiazolyl]-
• 2-Chloro-N-[4-(2,4,5-trimethylphenyl)-2-thiazolyl]acetamide

2-Chloro-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide

CAS: 733796-12-8

Versatile small molecule scaffold

Formula: C₁₄H₁₅ClN₂OS

Purity: Min. 95%

Molecular weight: 294.8 g/mol

Ref: 3D-IEB79612