CAS 733796-15-1

4-Ethyl 2-(2-methoxyethyl) 5-[(2-chloroacetyl)amino]-3-methyl-2,4-thiophenedicarboxylate

Description:

4-Ethyl 2-(2-methoxyethyl) 5-[(2-chloroacetyl)amino]-3-methyl-2,4-thiophenedicarboxylate, with the CAS number 733796-15-1, is a synthetic organic compound characterized by its complex structure, which includes a thiophene ring and multiple functional groups. This compound features an ethyl group and a methoxyethyl substituent, contributing to its hydrophobic and hydrophilic properties, respectively. The presence of a chloroacetyl group indicates potential reactivity, particularly in nucleophilic substitution reactions. The thiophene moiety is known for its aromatic stability and can participate in various chemical reactions, making this compound of interest in medicinal chemistry and materials science. Its potential applications may include use as an intermediate in the synthesis of pharmaceuticals or agrochemicals. The compound's solubility, stability, and reactivity will depend on the specific conditions, such as pH and solvent, which are crucial for its practical applications. As with many synthetic compounds, safety data and handling precautions should be considered due to the presence of chlorine and other reactive groups.

Formula: C₁₄H₁₈ClNO₆S

InChI: InChI=1S/C14H18ClNO6S/c1-4-21-13(18)10-8(2)11(14(19)22-6-5-20-3)23-12(10)16-9(17)7-15/h4-7H2,1-3H3,(H,16,17)

InChI key: InChIKey=BEOFEXXTXNZDAX-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C1=C(C(OCC)=O)C(C)=C(C(OCCOC)=O)S1

Synonyms:

• 2,4-Thiophenedicarboxylic acid, 5-[(chloroacetyl)amino]-3-methyl-, 4-ethyl 2-(2-methoxyethyl) ester
• 4-Ethyl 2-(2-methoxyethyl) 5-[(2-chloroacetyl)amino]-3-methyl-2,4-thiophenedicarboxylate
• 2,4-Thiophenedicarboxylic acid, 5-[(2-chloroacetyl)amino]-3-methyl-, 4-ethyl 2-(2-methoxyethyl) ester

4-Ethyl 2-(2-methoxyethyl) 5-(2-chloroacetamido)-3-methylthiophene-2,4-dicarboxylate

CAS: 733796-15-1

Versatile small molecule scaffold

Formula: C₁₄H₁₈ClNO₆S

Purity: Min. 95%

Molecular weight: 363.8 g/mol

Ref: 3D-IEB79615