CAS 733811-07-9
:2,4-Bis(4-methyl-1-piperazinyl)-3H-1,5-benzodiazepine
Description:
2,4-Bis(4-methyl-1-piperazinyl)-3H-1,5-benzodiazepine, identified by its CAS number 733811-07-9, is a synthetic compound belonging to the benzodiazepine class, which is known for its psychoactive properties. This substance features a benzodiazepine core structure, characterized by a fused benzene and diazepine ring, which contributes to its biological activity. The presence of two 4-methyl-1-piperazinyl groups enhances its pharmacological profile, potentially influencing its binding affinity to various neurotransmitter receptors, particularly those associated with the central nervous system. The compound may exhibit anxiolytic, sedative, or anticonvulsant effects, typical of many benzodiazepines, although specific biological activities and mechanisms of action would require empirical studies for confirmation. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many compounds in this class, safety and toxicity profiles are critical for understanding its potential therapeutic applications and risks.
Formula:C19H28N6
InChI:InChI=1S/C19H28N6/c1-22-7-11-24(12-8-22)18-15-19(25-13-9-23(2)10-14-25)21-17-6-4-3-5-16(17)20-18/h3-6H,7-15H2,1-2H3
InChI key:InChIKey=WJRMOKYTESYRBS-UHFFFAOYSA-N
SMILES:CN1CCN(C=2CC(=NC=3C(N2)=CC=CC3)N4CCN(C)CC4)CC1
Synonyms:- 2,4-Bis(4-methyl-1-piperazinyl)-3H-1,5-benzodiazepine
- 3H-1,5-Benzodiazepine, 2,4-bis(4-methyl-1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.