CAS 73384-60-8

2-[2-Methoxy-4-(methylsulfinyl)phenyl]-3H-imidazo[4,5-b]pyridine

Description:

2-[2-Methoxy-4-(methylsulfinyl)phenyl]-3H-imidazo[4,5-b]pyridine, with CAS number 73384-60-8, is a chemical compound that belongs to the class of imidazopyridines. This substance features a complex structure that includes an imidazo[4,5-b]pyridine core, which is fused to a phenyl ring substituted with a methoxy group and a methylsulfinyl group. The presence of the methoxy group contributes to its potential solubility and reactivity, while the methylsulfinyl group may impart unique electronic properties and influence biological activity. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of therapeutic agents. Its molecular structure suggests that it may interact with biological targets, making it a candidate for further research in drug discovery. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances.

Formula: C₁₄H₁₃N₃O₂S

InChI: InChI=1S/C14H13N3O2S/c1-19-12-8-9(20(2)18)5-6-10(12)13-16-11-4-3-7-15-14(11)17-13/h3-8H,1-2H3,(H,15,16,17)

InChI key: InChIKey=XMFCOYRWYYXZMY-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC(S(C)=O)=C1)C=2NC=3C(N2)=NC=CC3

Synonyms:

• AR-L 115BS
• 1H-Imidazo[4,5-b]pyridine, 2-[2-methoxy-4-(methylsulfinyl)phenyl]-
• Vardax
• 2-[2-Methoxy-4-(methylsulfinyl)phenyl]-3H-imidazo[4,5-b]pyridine
• 3H-Imidazo[4,5-b]pyridine, 2-[2-methoxy-4-(methylsulfinyl)phenyl]-

Sulmazole

CAS: 73384-60-8

Sulmazole

Purity: ≥95%

Molecular weight: 287.34g/mol

Ref: 54-BUP07727

Sulmazole

CAS: 73384-60-8

Sulmazole (AR-L 115-BS) is a small molecule Sulmazole is a small molecule cGMP-PDE inhibitor.Sulmazole is a competitive inhibitor of A1 adenosine receptors.

Formula: C₁₄H₁₃N₃O₂S

Purity: 99.94%

Color and Shape: Solid

Molecular weight: 287.34

Ref: TM-T28881