CAS 73392-01-5

2-bromo-1-(2,3-dihydro-1H-indol-1-yl)ethanone

Description:

2-bromo-1-(2,3-dihydro-1H-indol-1-yl)ethanone, with the CAS number 73392-01-5, is an organic compound characterized by its unique structure, which includes a bromine atom and an indole derivative. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The indole moiety contributes to its biological activity, as indole derivatives are often found in many natural products and exhibit a range of pharmacological properties. Additionally, the ethanone functional group indicates that it possesses ketone characteristics, which can influence its reactivity and interactions with other molecules. Overall, 2-bromo-1-(2,3-dihydro-1H-indol-1-yl)ethanone is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential biological activities.

Formula: C₁₀H₁₀BrNO

InChI: InChI=1/C10H10BrNO/c11-7-10(13)12-6-5-8-3-1-2-4-9(8)12/h1-4H,5-7H2

SMILES: c1ccc2c(c1)CCN2C(=O)CBr

Synonyms:

• 1-(Bromoacetyl)indoline
• 2-Brom-1-(2,3-dihydroindol-1-yl)ethanone

1-(Bromoacetyl)indoline

CAS: 73392-01-5

1-(Bromoacetyl)indoline is a chemical compound that can be used as a reaction component, reagent, or high-quality research chemical. It is a speciality chemical used in the production of fine chemicals and other organic compounds. 1-(Bromoacetyl)indoline is a versatile building block for synthesis of complex compounds with potential applications in pharmaceuticals, agrochemicals, and specialty chemicals.

Formula: C₁₀H₁₀BrNO

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 240.1 g/mol

Ref: 3D-FB127678