CymitQuimica logo

CAS 73396-58-4

:

4-Amino-5-tert-butyl-4H-1,2,4-triazole-3-thiol

Description:
4-Amino-5-tert-butyl-4H-1,2,4-triazole-3-thiol, with the CAS number 73396-58-4, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and a thiol group, contributing to its reactivity and potential applications in various fields, including agriculture and pharmaceuticals. The tert-butyl group enhances its lipophilicity, which can influence its biological activity and solubility. The presence of the thiol group suggests potential for redox reactions, making it a candidate for use as an antioxidant or in coordination chemistry. Additionally, compounds of this nature may exhibit fungicidal or herbicidal properties, making them valuable in crop protection. Its stability, solubility in organic solvents, and specific reactivity patterns are important characteristics that determine its utility in synthetic and applied chemistry. As with any chemical, safety data and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C6H12N4S
InChI:InChI=1/C6H12N4S/c1-6(2,3)4-8-9-5(11)10(4)7/h7H2,1-3H3,(H,9,11)
SMILES:CC(C)(C)c1nnc(n1N)S
Synonyms:
  • 4-amino-5-tert-butyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.