CAS 73397-12-3

6-chloro-9-nitro-5H-benzo[a]phenoxazin-5-one

Description:

6-Chloro-9-nitro-5H-benzo[a]phenoxazin-5-one is a synthetic organic compound characterized by its complex polycyclic structure, which includes a phenoxazine core. This compound features a chlorine atom and a nitro group, contributing to its unique chemical properties and reactivity. It is typically used in various applications, including as a dye or in biological research due to its potential fluorescence properties. The presence of the nitro group can enhance its electron-withdrawing characteristics, influencing its reactivity in chemical reactions. Additionally, the chlorine substituent may affect its solubility and interaction with biological systems. The compound's structure allows for potential applications in photodynamic therapy and as a fluorescent probe in biochemical assays. As with many synthetic compounds, safety and handling precautions are essential, as it may exhibit toxicity or environmental hazards. Overall, 6-chloro-9-nitro-5H-benzo[a]phenoxazin-5-one is a notable compound in the field of organic chemistry and materials science.

Formula: C₁₆H₇ClN₂O₄

InChI: InChI=1/C16H7ClN2O4/c17-13-15(20)10-4-2-1-3-9(10)14-16(13)23-12-7-8(19(21)22)5-6-11(12)18-14/h1-7H

SMILES: c1ccc2c(c1)c1c(c(c2=O)Cl)oc2cc(ccc2n1)N(=O)=O

Synonyms:

• 5H-Benzo[a]phenoxazin-5-one, 6-chloro-9-nitro-
• 6-Chloro-9-Nitro-5-Oxo-5H-Benzo[A]Phenoxazine
• 6-Chloro-9-nitro-5H-benzo[a]phenoxazin-5-one

6-chloro-9-nitro-5H-benzo[a]phenoxazin-5-one

CAS: 73397-12-3

Purity: 95.0%

Molecular weight: 326.69000244140625

Ref: 10-F512023