CymitQuimica logo

CAS 73399-86-7

:

5-Chloro-2-naphthalenecarbonitrile

Description:
5-Chloro-2-naphthalenecarbonitrile is an organic compound characterized by its naphthalene backbone, which is substituted with a chlorine atom and a cyano group. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the naphthalene structure. The chlorine atom introduces a degree of polarity, which can influence its reactivity and solubility in various solvents. The cyano group (-C≡N) is a strong electron-withdrawing group, making the compound potentially useful in various chemical reactions, including nucleophilic substitutions and as a building block in organic synthesis. Additionally, 5-Chloro-2-naphthalenecarbonitrile may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H6ClN
InChI:InChI=1S/C11H6ClN/c12-11-3-1-2-9-6-8(7-13)4-5-10(9)11/h1-6H
InChI key:InChIKey=KUOUXFRSMZDZFR-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(C#N)C=C2)C=CC1
Synonyms:
  • 5-Chloro-2-naphthalenecarbonitrile
  • 5-Chloronaphthalene-2-carbonitrile
  • 2-Naphthalenecarbonitrile, 5-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.