CAS 73399-89-0

1-(8-Chloro-2-naphthalenyl)ethanone

Description:

1-(8-Chloro-2-naphthalenyl)ethanone, with the CAS number 73399-89-0, is an organic compound characterized by its naphthalene structure substituted with a chloro group and an ethanone functional group. This compound typically appears as a solid or crystalline substance and is known for its aromatic properties due to the presence of the naphthalene ring. The chloro substituent introduces a degree of polarity and can influence the compound's reactivity, making it useful in various chemical reactions, including electrophilic substitutions. Its ethanone group contributes to its ketone characteristics, which can participate in nucleophilic addition reactions. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its unique structural features. Additionally, it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its potential applications and effects. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₂H₉ClO

InChI: InChI=1S/C12H9ClO/c1-8(14)10-6-5-9-3-2-4-12(13)11(9)7-10/h2-7H,1H3

InChI key: InChIKey=ZLBIWDXQTMXFFK-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=CC(C(C)=O)=C2)C=CC1

Synonyms:

• 1-(8-Chloronaphthalen-2-yl)ethan-1-one
• 1-(8-Chloro-2-naphthalenyl)ethanone
• Ethanone, 1-(8-chloro-2-naphthalenyl)-