CAS 73399-93-6

8-Amino-2-naphthalenecarbonitrile

Description:

8-Amino-2-naphthalenecarbonitrile is an organic compound characterized by its naphthalene structure, which features an amino group and a cyano group attached to the aromatic ring. The presence of the amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, while the cyano group (-C≡N) introduces a polar functional group that can participate in various chemical reactions, such as nucleophilic additions. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its chemical properties make it of interest in various fields, including medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of pharmaceuticals or as a building block for more complex molecules. Additionally, the compound's structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₁H₈N₂

InChI: InChI=1S/C11H8N2/c12-7-8-4-5-9-2-1-3-11(13)10(9)6-8/h1-6H,13H2

InChI key: InChIKey=UOHKMUCDRXPZLH-UHFFFAOYSA-N

SMILES: NC=1C2=C(C=CC(C#N)=C2)C=CC1

Synonyms:

• 2-Naphthalenecarbonitrile, 8-amino-
• 1-Aminonaphthalene-7-carbonitrile
• 8-Amino-2-naphthalenecarbonitrile