CAS 73402-27-4

3-(4-Chlorophenyl)-6-oxo-1(6H)-pyridazinepropanoic acid

Description:

3-(4-Chlorophenyl)-6-oxo-1(6H)-pyridazinepropanoic acid, with the CAS number 73402-27-4, is a chemical compound that belongs to the class of pyridazine derivatives. This substance features a pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a 4-chlorophenyl group indicates that there is a chlorine substituent on the phenyl ring, which can influence the compound's reactivity and biological activity. The "6-oxo" designation suggests the presence of a carbonyl group (C=O) at the 6-position of the pyridazine ring, contributing to its potential as a reactive intermediate. The propanoic acid moiety indicates that the compound has a carboxylic acid functional group, which can participate in various chemical reactions, including esterification and acid-base reactions. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation.

Formula: C₁₃H₁₁ClN₂O₃

InChI: InChI=1S/C13H11ClN2O3/c14-10-3-1-9(2-4-10)11-5-6-12(17)16(15-11)8-7-13(18)19/h1-6H,7-8H2,(H,18,19)

InChI key: InChIKey=WBDKMRXSDHJUOG-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1N=C(C=CC1=O)C2=CC=C(Cl)C=C2

Synonyms:

• 3-(4-Chlorophenyl)-6-oxo-1(6H)-pyridazinepropanoic acid
• 1(6H)-Pyridazinepropanoic acid, 3-(4-chlorophenyl)-6-oxo-