CAS 73402-28-5

5,6-Dihydro-6-oxo-3-phenyl-1(4H)-pyridazinepropanoic acid

Description:

5,6-Dihydro-6-oxo-3-phenyl-1(4H)-pyridazinepropanoic acid, identified by its CAS number 73402-28-5, is a chemical compound characterized by its pyridazine core structure, which features a phenyl group and a propanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the keto group (6-oxo) and the dihydro configuration suggests that it may participate in various chemical reactions, including nucleophilic additions or substitutions. Its structural features may also influence its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the compound's unique arrangement of functional groups may impart specific pharmacological properties, warranting further investigation into its potential applications in therapeutic contexts. As with many organic compounds, safety and handling precautions should be observed due to the potential for toxicity or reactivity.

Formula: C₁₃H₁₄N₂O₃

InChI: InChI=1S/C13H14N2O3/c16-12-7-6-11(10-4-2-1-3-5-10)14-15(12)9-8-13(17)18/h1-5H,6-9H2,(H,17,18)

InChI key: InChIKey=LCYAKPCSNVSBLI-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1N=C(CCC1=O)C2=CC=CC=C2

Synonyms:

• 5,6-Dihydro-6-oxo-3-phenyl-1(4H)-pyridazinepropanoic acid
• 1(4H)-Pyridazinepropanoic acid, 5,6-dihydro-6-oxo-3-phenyl-