CAS 73402-80-9
:N-tert-butyl-3-phenylprop-2-yn-1-amine
Description:
N-tert-butyl-3-phenylprop-2-yn-1-amine is an organic compound characterized by its unique structure, which includes a tert-butyl group, a phenyl group, and an alkyne functional group. This compound features a propargyl amine structure, where the amine group is attached to a carbon chain that includes a triple bond. The presence of the tert-butyl group contributes to its steric bulk, which can influence its reactivity and solubility. The phenyl group adds aromatic characteristics, potentially affecting the compound's electronic properties and interactions with other molecules. N-tert-butyl-3-phenylprop-2-yn-1-amine is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may exhibit moderate to high stability under standard conditions but can be sensitive to moisture and air, which could lead to degradation or polymerization. This compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in the development of pharmaceuticals and other chemical products.
Formula:C13H17N
InChI:InChI=1/C13H17N/c1-13(2,3)14-11-7-10-12-8-5-4-6-9-12/h4-6,8-9,14H,11H2,1-3H3
SMILES:CC(C)(C)NCC#Cc1ccccc1
Synonyms:- 2-propyn-1-amine, N-(1,1-dimethylethyl)-3-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.