CAS 7341-24-4
:2-Methylbenzenemethanethiol
Description:
2-Methylbenzenemethanethiol, also known as o-tolylmethanethiol, is an organic compound characterized by the presence of a thiol (-SH) group attached to a benzene ring that is further substituted with a methyl group. This compound belongs to the class of thiols, which are known for their distinctive odors and reactivity. It typically appears as a colorless to pale yellow liquid and has a strong, often unpleasant smell reminiscent of garlic or rotten cabbage, which is common among thiols. The presence of both the methyl group and the thiol group contributes to its unique chemical properties, including its ability to participate in various chemical reactions such as nucleophilic substitutions and oxidation. 2-Methylbenzenemethanethiol is soluble in organic solvents and has limited solubility in water. It is used in various applications, including as a flavoring agent and in the synthesis of other chemical compounds. Due to its potential for toxicity and strong odor, handling this substance requires appropriate safety precautions.
Formula:C8H10S
InChI:InChI=1S/C8H10S/c1-7-4-2-3-5-8(7)6-9/h2-5,9H,6H2,1H3
InChI key:InChIKey=PJUDFYDAJBQPEA-UHFFFAOYSA-N
SMILES:C(S)C1=C(C)C=CC=C1
Synonyms:- Methanethiol, o-tolyl-
- 2-Methylbenzyl mercaptan
- o-Xylene-α-thiol
- Benzenemethanethiol, 2-methyl-
- 2-Methylbenzenemethanethiol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2-Methylphenyl)methanethiol
CAS:(2-Methylphenyl)methanethiolFormula:C8H10SPurity:98%Color and Shape:Colourless LiquidMolecular weight:138.229992-Methylbenzyl mercaptan
CAS:2-Methylbenzyl mercaptan is a covalent probe for the detection of yields. It can be used as an additive in organic chemistry to increase the efficiency of reactions. 2-Methylbenzyl mercaptan has been shown to catalyze the desulfurization of amines and dithiocarbamates. This compound reacts with electrophiles such as oxygen, chlorine, and bromine. The reaction forms a crosslinked structure that is resistant to further reaction with these electrophiles. 2-Methylbenzyl mercaptan has also been shown to react with amines and form desulfurized products through transfer of a methyl group from the mercaptan to the amine.Formula:C8H10SPurity:Min. 95%Molecular weight:138.23 g/mol




