
CAS 7341-63-1
:N-Phenyl-N′-2-propen-1-ylthiourea
Description:
N-Phenyl-N′-2-propen-1-ylthiourea, with the CAS number 7341-63-1, is an organic compound characterized by its thiourea functional group, which consists of a sulfur atom double-bonded to a carbon atom and bonded to two nitrogen atoms. This compound features a phenyl group and a propenyl group, contributing to its unique reactivity and properties. It is typically a white to off-white solid and is soluble in organic solvents. The presence of the thiourea moiety allows for potential applications in various fields, including agriculture as a pesticide or herbicide, and in medicinal chemistry for its biological activity. The compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Additionally, its reactivity can be influenced by the presence of the double bond in the propenyl group, which may participate in further chemical reactions. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C10H12N2S
InChI:InChI=1S/C10H12N2S/c1-2-8-11-10(13)12-9-6-4-3-5-7-9/h2-7H,1,8H2,(H2,11,12,13)
InChI key:InChIKey=RJTICPGQFMYYEG-UHFFFAOYSA-N
SMILES:N(C(NCC=C)=S)C1=CC=CC=C1
Synonyms:- Urea, 1-allyl-3-phenyl-2-thio-
- N-Allyl-N′-phenylthiourea
- Thiourea, N-phenyl-N′-2-propen-1-yl-
- N-Phenyl-N′-2-propen-1-ylthiourea
- Thiourea, N-phenyl-N′-2-propenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.