CAS 7341-87-9

1-methyl-5-(trifluoromethyl)-1,3-dihydro-2H-benzimidazole-2-thione

Description:

1-Methyl-5-(trifluoromethyl)-1,3-dihydro-2H-benzimidazole-2-thione is a chemical compound characterized by its unique structure, which includes a benzimidazole core with a methyl group and a trifluoromethyl group. This compound typically exhibits properties associated with thiones, such as potential reactivity in nucleophilic substitution reactions due to the presence of the sulfur atom in the thione functional group. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the methyl group contributes to the stability of the molecule. The compound may display various physical properties, including solubility in organic solvents, and may be used in research related to pharmaceuticals or agrochemicals. Its specific reactivity and applications can vary based on the context of its use, including potential roles as a building block in organic synthesis or as a target for biological activity studies.

Formula: C₉H₇F₃N₂S

InChI: InChI=1/C9H7F3N2S/c1-14-7-3-2-5(9(10,11)12)4-6(7)13-8(14)15/h2-4H,1H3,(H,13,15)

SMILES: Cn1c2ccc(cc2nc1S)C(F)(F)F

Synonyms:

• 1-Methyl-5-(trifluoromethyl)-2,3-dihydro-1H-benzo[d]imidazole-2-thione
• 2H-benzimidazole-2-thione, 1,3-dihydro-1-methyl-5-(trifluoromethyl)-