CAS 73413-79-3
:camphorquinone-10-sulfonic acid
Description:
Camphorquinone-10-sulfonic acid is an organic compound that belongs to the class of quinones, specifically a derivative of camphor. It is characterized by its sulfonic acid group, which enhances its solubility in water and makes it useful in various applications. This compound typically appears as a yellow to brown solid and is known for its role as a photoinitiator in dental materials and polymer chemistry, where it facilitates the curing process upon exposure to light. Camphorquinone-10-sulfonic acid is also recognized for its ability to absorb ultraviolet light, which is crucial in initiating polymerization reactions. Additionally, its sulfonic acid functionality contributes to its reactivity and compatibility with other chemical systems. Safety considerations include handling it with care, as with many chemical substances, due to potential irritant properties. Overall, camphorquinone-10-sulfonic acid is valued for its unique chemical properties and versatility in various industrial and research applications.
Formula:C10H14O5S
InChI:InChI=1/C10H14O5S/c1-9(2)6-3-4-10(9,5-16(13,14)15)8(12)7(6)11/h6H,3-5H2,1-2H3,(H,13,14,15)/t6-,10-/m0/s1
SMILES:CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)O)C(=O)C2=O
Synonyms:- Camphorquinone-10-Sulfonic Acid, Hydrate
- [(1S,4S)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]hept-1-yl]methanesulfonic acid
- [(1R,4R)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]hept-1-yl]methanesulfonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Camphorquinone-10-sulphonic acid hydrate
CAS:Camphorquinone-10-sulphonic acid hydrateFormula:C10H14O5S·H2OPurity:≥95%Color and Shape: solidMolecular weight:264.30g/molCamphorquinone-10-sulfonic Acid Hydrate
CAS:Controlled Product<p>Applications A crystalline water-soluble reagent that is useful for specific, reversible modification of the guanidino groups of arginine residues. Suitable for use with small arginine-containing molecules.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Wallace, C.J.A., et al.: Biochem. J., 215, 651 (1983), Dailey, H.A., et al.: J. Biol. Chem., 261, 7902 (1986),<br></p>Formula:C10H14O5S·H2OColor and Shape:NeatMolecular weight:264.30

