CymitQuimica logo

CAS 73415-62-0

:

N-(1-Phenylethyl)-4-piperidinecarboxamide

Description:
N-(1-Phenylethyl)-4-piperidinecarboxamide, identified by its CAS number 73415-62-0, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is substituted with a phenylethyl group and a carboxamide functional group. This compound is typically characterized by its moderate to high lipophilicity, which can influence its pharmacokinetic properties, such as absorption and distribution in biological systems. The presence of the piperidine moiety often imparts basic properties, allowing it to interact with various biological targets, potentially making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological profile. Its structural features suggest potential applications in drug development, particularly in areas related to central nervous system activity or as a scaffold for further chemical modifications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C14H20N2O
InChI:InChI=1S/C14H20N2O/c1-11(12-5-3-2-4-6-12)16-14(17)13-7-9-15-10-8-13/h2-6,11,13,15H,7-10H2,1H3,(H,16,17)
InChI key:InChIKey=PJQBQLWAAJNUTO-UHFFFAOYSA-N
SMILES:C(NC(=O)C1CCNCC1)(C)C2=CC=CC=C2
Synonyms:
  • N-(1-Phenylethyl)-4-piperidinecarboxamide
  • 4-Piperidinecarboxamide, N-(1-phenylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.