CymitQuimica logo

CAS 73418-87-8

:

5-trifluoromethyl-2-pyrimidinamine

Description:
5-Trifluoromethyl-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its amine functional group contributes to its basicity and reactivity, allowing for various chemical transformations, including nucleophilic substitutions. The trifluoromethyl group can also impart unique electronic properties, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the compound's structure suggests potential interactions with biological targets, which may be explored in drug development. Safety data should be consulted for handling and usage, as fluorinated compounds can exhibit specific toxicity profiles. Overall, 5-trifluoromethyl-2-pyrimidinamine is a versatile compound with significant implications in various fields of research.
Formula:C5H4F3N3
InChI:InChI=1/C5H4F3N3/c6-5(7,8)3-1-10-4(9)11-2-3/h1-2H,(H2,9,10,11)
InChI key:LOOGTXVQDBMCOL-UHFFFAOYSA-N
SMILES:c1c(cnc(=N)[nH]1)C(F)(F)F
Synonyms:
  • 5-(Trifluoromethyl)Pyrimidin-2-Amine
  • 2-(Trifluoromethyl)pyrimidin-5-amine
Found 4 products.