CAS 7342-02-1
:N,3-diphenylprop-2-ynamide
Description:
N,3-diphenylprop-2-ynamide, identified by its CAS number 7342-02-1, is an organic compound characterized by its unique structure, which includes a propyne moiety and two phenyl groups attached to the nitrogen atom of an amide functional group. This compound typically exhibits a high degree of stability due to the resonance provided by the phenyl rings, which can influence its reactivity and solubility. It is generally soluble in organic solvents, reflecting its non-polar characteristics. The presence of the alkyne functional group contributes to its potential reactivity, particularly in coupling reactions or as a precursor in organic synthesis. Additionally, N,3-diphenylprop-2-ynamide may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its physical properties, such as melting point and boiling point, can vary based on purity and specific conditions. Overall, this compound serves as a valuable building block in various chemical applications, particularly in the synthesis of more complex organic molecules.
Formula:C15H11NO
InChI:InChI=1/C15H11NO/c17-15(16-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H,(H,16,17)
Synonyms:- N,3-Diphenylprop-2-ynamide
- 2-propynamide, N,3-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.