CAS 7342-42-9
:2-(2-Thienylthio)acetic acid
Description:
2-(2-Thienylthio)acetic acid, with the CAS number 7342-42-9, is an organic compound characterized by the presence of both a thienyl group and a carboxylic acid functional group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly due to the presence of the thienyl group, which can enhance biological activity. The carboxylic acid functional group imparts acidic properties, allowing for participation in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit interesting solubility characteristics, influenced by the thienyl structure, which can affect its behavior in different solvents. Overall, 2-(2-Thienylthio)acetic acid is a versatile compound with potential utility in various chemical and pharmaceutical applications.
Formula:C6H6O2S2
InChI:InChI=1S/C6H6O2S2/c7-5(8)4-10-6-2-1-3-9-6/h1-3H,4H2,(H,7,8)
InChI key:InChIKey=FGTPHFGZGZOZGD-UHFFFAOYSA-N
SMILES:S(CC(O)=O)C1=CC=CS1
Synonyms:- (2-Thienylsulfanyl)acetic acid
- (2-Thienylthio)acetic acid
- 2-(2-Thienylthio)acetic acid
- 2-(Thiophen-2-ylsulfanyl)acetic acid
- 2-(Thiophen-2-ylthio)acetic acid
- Acetic Acid, 2-(2-Thienylthio)-
- Acetic acid, (2-thienylthio)-
- (Thiophen-2-ylsulfanyl)-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
