CAS 73424-97-2

1,3-Dihydro-5-methyl-2H-indole-2-thione

Description:

1,3-Dihydro-5-methyl-2H-indole-2-thione, with the CAS number 73424-97-2, is a heterocyclic organic compound characterized by its indole structure, which features a fused benzene and pyrrole ring. This compound contains a thione functional group, which is a sulfur analog of a ketone, indicating the presence of a sulfur atom double-bonded to a carbon atom. The methyl group at the 5-position contributes to its unique properties and reactivity. Typically, compounds of this class exhibit interesting biological activities, including potential antimicrobial and anticancer properties, making them of interest in medicinal chemistry. The presence of the thione group can also influence the compound's reactivity and stability, as thiones can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular structure and the presence of functional groups. Overall, 1,3-Dihydro-5-methyl-2H-indole-2-thione represents a valuable structure for further research in organic and medicinal chemistry.

Formula: C₉H₉NS

InChI: InChI=1S/C9H9NS/c1-6-2-3-8-7(4-6)5-9(11)10-8/h2-4H,5H2,1H3,(H,10,11)

InChI key: InChIKey=YEPDEDLPPLWRPN-UHFFFAOYSA-N

SMILES: S=C1NC=2C(C1)=CC(C)=CC2

Synonyms:

• 1,3-Dihydro-5-methyl-2H-indole-2-thione
• 2H-Indole-2-thione, 1,3-dihydro-5-methyl-