CAS 73425-13-5
:5-fluoroindoline-2-thione
Description:
5-Fluoroindoline-2-thione is a chemical compound characterized by its unique structure, which includes an indoline ring system substituted with a fluorine atom and a thione functional group. This compound typically exhibits properties associated with both heterocycles and sulfur-containing compounds. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it an interesting candidate for drug design. Additionally, the thione group may contribute to its reactivity and interaction with biological targets. The compound is usually synthesized through specific organic reactions that allow for the introduction of the fluorine atom and the formation of the thione group. As with many chemical substances, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, 5-fluoroindoline-2-thione represents a valuable compound in the field of organic chemistry and drug discovery.
Formula:C8H6FNS
InChI:InChI=1/C8H6FNS/c9-6-1-2-7-5(3-6)4-8(11)10-7/h1-3H,4H2,(H,10,11)
SMILES:c1cc2c(cc1F)CC(=S)N2
Synonyms:- 5-Fluoro-1,3-dihydro-indole-2-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.