CAS 73428-04-3
:(3-nitronaphthalen-2-yl)methanol
Description:
(3-Nitronaphthalen-2-yl)methanol is an organic compound characterized by its structure, which features a naphthalene ring substituted with a nitro group at the 3-position and a hydroxymethyl group at the 2-position. This compound is typically a solid at room temperature and may exhibit a yellow to brown coloration due to the presence of the nitro group, which can influence its electronic properties. It is likely to be soluble in organic solvents but may have limited solubility in water due to its hydrophobic naphthalene core. The presence of the nitro group can impart certain reactivity, making it a potential candidate for further chemical transformations, such as reduction or substitution reactions. Additionally, the compound may exhibit interesting biological activities, which could be explored in medicinal chemistry. Safety data should be consulted, as nitro compounds can be hazardous and may require careful handling. Overall, (3-nitronaphthalen-2-yl)methanol is a compound of interest in both synthetic organic chemistry and potential applications in various fields.
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c13-7-10-5-8-3-1-2-4-9(8)6-11(10)12(14)15/h1-6,13H,7H2
SMILES:c1ccc2cc(c(cc2c1)CO)N(=O)=O
Synonyms:- 3-Nitro-2-Naphthalenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.