CAS 73437-06-6

5-Bromo-3-methyl-1,2-benzisothiazole

Description:

5-Bromo-3-methyl-1,2-benzisothiazole is a heterocyclic organic compound characterized by its benzisothiazole structure, which incorporates a bromine atom and a methyl group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the bromine atom enhances its reactivity, making it useful in synthetic chemistry. The methyl group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. Additionally, benzisothiazole derivatives are often studied for their biological activities, including antimicrobial and antifungal properties. The compound's molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 5-Bromo-3-methyl-1,2-benzisothiazole is a significant compound in research and industrial applications, warranting further exploration of its properties and uses.

Formula: C₈H₆BrNS

InChI: InChI=1S/C8H6BrNS/c1-5-7-4-6(9)2-3-8(7)11-10-5/h2-4H,1H3

InChI key: InChIKey=FBFJWKGJYZIEJK-UHFFFAOYSA-N

SMILES: CC=1C=2C(=CC=C(Br)C2)SN1

Synonyms:

• 5-Bromo-3-methyl-1,2-benzisothiazole
• 1,2-Benzisothiazole, 5-bromo-3-methyl-