CAS 73443-76-2

2-bromo-4-methyl-1,3-benzothiazole

Description:

2-Bromo-4-methyl-1,3-benzothiazole is a heterocyclic organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a bromine atom and a methyl group substituent, which influence its chemical reactivity and physical properties. Typically, it appears as a solid at room temperature and is soluble in organic solvents. The presence of the bromine atom can enhance its reactivity, making it useful in various chemical synthesis applications, including pharmaceuticals and agrochemicals. Additionally, the methyl group can affect the compound's electronic properties and steric hindrance, influencing its interactions with biological systems. 2-Bromo-4-methyl-1,3-benzothiazole may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks. Overall, this compound is significant in organic synthesis and research due to its unique structural features and potential applications.

Formula: C₈H₆BrNS

InChI: InChI=1/C8H6BrNS/c1-5-3-2-4-6-7(5)10-8(9)11-6/h2-4H,1H3

SMILES: Cc1cccc2c1nc(Br)s2

Synonyms:

• 2-Bromo-4-methylbenzothiazole
• Benzothiazole, 2-Bromo-4-Methyl-
• 2-Bromo-4-methyl-1,3-benzothiazole

2-Bromo-4-methylbenzo[d]thiazole

CAS: 73443-76-2

Formula: C₈H₆BrNS

Purity: 97%

Color and Shape: Solid

Molecular weight: 228.1089

Ref: IN-DA005ZI8

2-Bromo-4-methylbenzo[d]thiazole

CAS: 73443-76-2

2-Bromo-4-methylbenzo[d]thiazole

Purity: 97%

Molecular weight: 228.11g/mol

Ref: 54-OR94755

2-BROMO-4-METHYLBENZO[D]THIAZOLE

CAS: 73443-76-2

Formula: C₈H₆BrNS

Purity: 97%

Color and Shape: Solid

Molecular weight: 228.11

Ref: 10-F471707