CAS 73443-85-3

4-Bromo-2(3H)-benzothiazolone

Description:

4-Bromo-2(3H)-benzothiazolone is an organic compound characterized by its unique structure, which includes a bromine atom and a benzothiazole moiety. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. The presence of the bromine substituent can influence its reactivity, making it a useful intermediate in synthetic chemistry. Additionally, 4-Bromo-2(3H)-benzothiazolone may exhibit biological activity, which has been explored in research contexts. Its molecular structure contributes to its chemical behavior, including potential interactions with biological targets. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as it may pose risks if not managed properly. Overall, this compound represents a valuable entity in the study of organic chemistry and its applications.

Formula: C₇H₄BrNOS

InChI: InChI=1S/C7H4BrNOS/c8-4-2-1-3-5-6(4)9-7(10)11-5/h1-3H,(H,9,10)

InChI key: InChIKey=JOFGIHYTADMYMX-UHFFFAOYSA-N

SMILES: BrC1=C2C(SC(=O)N2)=CC=C1

Synonyms:

• 4-Bromo-2(3H)-benzothiazolone
• 4-Bromobenzo[d]thiazol-2(3H)-one
• 2(3H)-Benzothiazolone, 4-bromo-

4-Bromobenzo[d]thiazol-2(3H)-one

CAS: 73443-85-3

Formula: C₇H₄BrNOS

Purity: 95%

Color and Shape: Solid

Molecular weight: 230.0818

Ref: IN-DA005E0F