CymitQuimica logo

CAS 73448-14-3

:

1,1-Dimethylethyl 5-hexynoate

Description:
1,1-Dimethylethyl 5-hexynoate, with the CAS number 73448-14-3, is an organic compound characterized by its ester functional group. It features a hexynoate structure, which includes a terminal alkyne, contributing to its reactivity and potential applications in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric hindrance, influencing its physical and chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The alkyne moiety can participate in various chemical reactions, such as nucleophilic additions and cycloadditions, making it valuable in synthetic organic chemistry. Additionally, its unique structure may impart specific characteristics such as volatility and reactivity, which can be exploited in various industrial applications, including the synthesis of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H16O2
InChI:InChI=1S/C10H16O2/c1-5-6-7-8-9(11)12-10(2,3)4/h1H,6-8H2,2-4H3
InChI key:InChIKey=XHIPLUJCVSEZTN-UHFFFAOYSA-N
SMILES:O(C(CCCC#C)=O)C(C)(C)C
Synonyms:
  • 5-Hexynoic acid tert-butyl ester
  • 5-Hexynoic acid, 1,1-dimethylethyl ester
  • tert-Butyl 5-hexynoate
  • 1,1-Dimethylethyl 5-hexynoate
Found 4 products.