CymitQuimica logo

CAS 73448-32-5

:

4-methyl-2-oxo-2H-chromen-7-yl 2-(acetylamino)-2-deoxy-4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside

Description:
4-Methyl-2-oxo-2H-chromen-7-yl 2-(acetylamino)-2-deoxy-4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside, with CAS number 73448-32-5, is a complex organic compound characterized by its chromone structure, which features a fused benzopyran ring system. This compound contains multiple functional groups, including an acetylamino group and glycosidic linkages, indicating its potential biological activity and solubility properties. The presence of sugar moieties, specifically beta-D-galactopyranosyl and beta-D-glucopyranoside units, suggests that it may exhibit properties typical of glycosides, such as enhanced solubility in polar solvents and potential interactions with biological receptors. The methyl and keto groups contribute to its stability and reactivity, while the overall structure may influence its pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm purity and structural integrity.
Formula:C24H31NO13
InChI:InChI=1/C24H31NO13/c1-9-5-16(29)35-13-6-11(3-4-12(9)13)34-23-17(25-10(2)28)19(31)22(15(8-27)37-23)38-24-21(33)20(32)18(30)14(7-26)36-24/h3-6,14-15,17-24,26-27,30-33H,7-8H2,1-2H3,(H,25,28)/t14-,15-,17-,18+,19-,20+,21-,22-,23-,24+/m1/s1
Sort by

Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
  • 4-Methylumbelliferyl 2-acetamido-2-deoxy-4-O-b-D-galactopyranosyl-b-D-glucopyranoside

    CAS:
    4-Methylumbelliferyl 2-acetamido-2-deoxy-4-O-b-D-galactopyranosyl-b-D-glucopyranoside is a chemiluminescent substrate that is used in diagnostic tests. This compound has been approved by the FDA and EPA for use in food testing, as well as for the detection of certain bacteria, parasites, and fungi. It is also used to detect protein kinase activity in cells or tissue samples. 4MUG can be conjugated to an enzyme or antibody to produce a fluorescent signal when activated by light at 350 nm. The compound has been shown to be nonfluorescent when in the dark, but will emit fluorescence upon activation with light at 350 nm.
    Purity:Min. 95%
    Molecular weight:541.5 g/mol

    Ref: 3D-EM171189

    ne
    To inquire