CAS 73449-07-7
:2'-deoxy-2'-fluoroadenosine 5'-(tetrahydrogen triphosphate)
Description:
2'-Deoxy-2'-fluoroadenosine 5'-(tetrahydrogen triphosphate), commonly referred to as dFATP, is a modified nucleotide that plays a significant role in biochemical research, particularly in studies involving DNA synthesis and polymerase activity. This compound is characterized by the presence of a fluorine atom at the 2' position of the ribose sugar, which distinguishes it from the natural nucleotide deoxyadenosine triphosphate (dATP). The fluorine substitution can influence the stability and reactivity of the nucleotide, making it useful for probing enzyme mechanisms and for applications in molecular biology. dFATP is typically used as a substrate in DNA polymerization reactions, where it can be incorporated into DNA strands, allowing researchers to study the effects of fluorine on DNA structure and function. Additionally, its triphosphate form provides the necessary energy for incorporation into nucleic acids. The compound is often utilized in various experimental settings, including the development of antiviral agents and in the study of DNA replication and repair processes.
Formula:C10H15FN5O12P3
InChI:InChI=1/C10H15FN5O12P3/c11-5-7(17)4(1-25-30(21,22)28-31(23,24)27-29(18,19)20)26-10(5)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17H,1H2,(H,21,22)(H,23,24)(H2,12,13,14)(H2,18,19,20)/t4-,5-,7-,10-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)F)O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2'-Deoxy-2'-fluoroadenosine-5'-triphosphate tetralithium salt
CAS:2'-Deoxy-2'-fluoroadenosine-5'-triphosphate tetralithium salt (FdATP) is a competitive inhibitor of ATP. It inhibits the synthesis of RNA, DNA, and protein in cell culture at high concentrations. FdATP is also an analog of adenosine triphosphate (ATP), which is needed for cellular energy production. The competitive inhibition of ATP by FdATP prevents the formation of a phosphorylated enzyme that is required for the initiation of DNA synthesis. This can lead to cell death, as the cells cannot produce proteins required for growth and replication.Formula:C10H11FN5O12P3•Li4Purity:Min. 95%Color and Shape:PowderMolecular weight:532.9 g/mol2'-Deoxy-2'-fluoroadenosine-5'-triphosphate
CAS:<p>2'-Deoxy-2'-fluoroadenosine-5'-triphosphate is an analog of adenosine triphosphate (ATP). It inhibits the synthesis of RNA by binding to the ribonucleotide reductase enzyme. This inhibition leads to the inhibition of DNA synthesis, which in turn prevents cell division and/or causes cell death. The inhibitory effect of 2'-deoxy-2'-fluoroadenosine-5'-triphosphate on protein and DNA synthesis has been shown in vivo and in vitro using cell culture techniques. This compound inhibits topoisomerase II, a key enzyme in DNA replication, at high concentrations.</p>Formula:C10H15FNO12P3Purity:Min. 95%Molecular weight:509.18 g/mol2'-Deoxy-2'-fluoroadenosine-5'-triphosphate lithium salt - 100mM aqueous solution
CAS:2'-Deoxy-2'-fluoroadenosine-5'-triphosphate lithium salt is an analog of ATP that has significant inhibitory effect on DNA polymerase. It inhibits the synthesis of RNA and protein by binding to the enzyme DNA gyrase. This drug is used in cell culture as a nucleotide analog to study how cells are affected by atp analogs. 2'-Deoxy-2'-fluoroadenosine-5'-triphosphate lithium salt is used at high concentrations in vitro, where it inhibits topoisomerases and prevents cell division.Formula:C10H11FN5O12P3·4LiPurity:Min. 95%Molecular weight:532.9 g/mol

