CAS 7345-76-8

2,5-Dimethyl benzo[b]thiophene-2,5-dicarboxylate

Description:

2,5-Dimethyl benzo[b]thiophene-2,5-dicarboxylate is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with two methyl groups and two carboxylate ester functionalities. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the thiophene ring, which contributes to its stability and potential reactivity. The carboxylate groups enhance its solubility in polar solvents and can participate in various chemical reactions, making it useful in organic synthesis and materials science. Additionally, the presence of methyl groups can influence its electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. This compound may also exhibit interesting photophysical properties, making it a candidate for applications in organic electronics or as a building block in the synthesis of more complex organic materials. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₂H₁₀O₄S

InChI: InChI=1S/C12H10O4S/c1-15-11(13)7-3-4-9-8(5-7)6-10(17-9)12(14)16-2/h3-6H,1-2H3

InChI key: InChIKey=XHEKZPXGTIMGQC-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC=2C(S1)=CC=C(C(OC)=O)C2

Synonyms:

• Benzo[b]thiophene-2,5-dicarboxylic acid, 2,5-dimethyl ester
• Benzo[b]thiophene-2,5-dicarboxylic acid, dimethyl ester
• 2,5-Dimethyl benzo[b]thiophene-2,5-dicarboxylate