CymitQuimica logo

CAS 734518-22-0

:

7-chloro-3-(1-methylpiperidin-4-yl)-1H-indole

Description:
7-Chloro-3-(1-methylpiperidin-4-yl)-1H-indole is a chemical compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 7-position and a 1-methylpiperidin-4-yl group at the 3-position contributes to its unique properties. This compound is often studied for its potential biological activity, particularly in the context of pharmacology, where it may exhibit effects on neurotransmitter systems. Its molecular structure suggests it may interact with various receptors, making it of interest in drug development. The piperidine moiety can enhance solubility and bioavailability, which are critical factors in medicinal chemistry. Additionally, the compound's stability, reactivity, and solubility in different solvents can vary based on its functional groups and overall structure. As with many chemical substances, safety and handling precautions are essential, particularly due to the presence of chlorine, which can pose health risks if not managed properly.
Formula:C14H17ClN2
InChI:InChI=1/C14H17ClN2/c1-17-7-5-10(6-8-17)12-9-16-14-11(12)3-2-4-13(14)15/h2-4,9-10,16H,5-8H2,1H3
SMILES:CN1CCC(CC1)c1c[nH]c2c1cccc2Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.