CAS 734524-15-3

7-fluoroquinoline-3-carboxylic acid

Description:

7-Fluoroquinoline-3-carboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a fluorine atom at the 7-position and a carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic nature of the quinoline ring enhances its hydrophobic characteristics. It may participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions, owing to the functional groups present. Additionally, compounds of this class are often studied for their biological activities, including antimicrobial and anti-inflammatory properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Overall, 7-fluoroquinoline-3-carboxylic acid represents a versatile scaffold in organic synthesis and pharmaceutical research.

Formula: C₁₀H₆FNO₂

InChI: InChI=1/C10H6FNO2/c11-8-2-1-6-3-7(10(13)14)5-12-9(6)4-8/h1-5H,(H,13,14)

SMILES: c1cc(cc2c1cc(cn2)C(=O)O)F

Synonyms:

• 3-Quinolinecarboxylic Acid, 7-Fluoro-
• 7-Fluoroquinoline-3-carboxylic acid
• 3-Carboxy-7-fluoroquinoline

7-Fluoroquinoline-3-carboxylic acid

CAS: 734524-15-3

Formula: C₁₀H₆FNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.1585

Ref: IN-DA005ZI2

7-Fluoroquinoline-3-carboxylic acid

CAS: 734524-15-3

7-Fluoroquinoline-3-carboxylic acid

Formula: C₁₀H₆FNO₂

Purity: ≥95%

Color and Shape: yellow powder

Molecular weight: 191.16g/mol

Ref: 54-PC49032

7-FLUOROQUINOLINE-3-CARBOXYLIC ACID

CAS: 734524-15-3

Formula: C₁₀H₆FNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.161

Ref: 10-F305246