CAS 734529-57-8
:(S)-3-Amino-3-(3-nitrophenyl)propionic acid
Description:
(S)-3-Amino-3-(3-nitrophenyl)propionic acid is an amino acid derivative characterized by its chiral center, which imparts specific stereochemical properties. This compound features an amino group (-NH2), a carboxylic acid group (-COOH), and a nitrophenyl substituent, which significantly influences its chemical reactivity and biological activity. The presence of the nitro group (-NO2) on the phenyl ring enhances its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The compound is soluble in polar solvents due to its ionic and polar functional groups, which also contribute to its ability to form hydrogen bonds. Its chirality may affect its interaction with biological systems, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. Additionally, the compound's structural features suggest potential applications in the synthesis of more complex molecules in organic chemistry. Overall, (S)-3-Amino-3-(3-nitrophenyl)propionic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C9H10N2O4
InChI:InChI=1/C9H10N2O4/c10-8(5-9(12)13)6-2-1-3-7(4-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)/t8-/m0/s1
SMILES:c1cc(cc(c1)N(=O)=O)[C@H](CC(=O)O)N
Synonyms:- (3S)-3-Amino-3-(3-nitrophenyl)propanoic acid
- Benzenepropanoic acid, beta-amino-3-nitro-, (betaS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-3-Amino-3-(3-nitrophenyl)propionic acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H10N2O4Purity:95%Molecular weight:210.19(S)-3-Amino-3-(3-nitro-phenyl)-propionic acid
CAS:Formula:C9H10N2O4Purity:96%Color and Shape:SolidMolecular weight:210.1867(S)-3-Amino-3-(3-nitrophenyl)propionic acid
CAS:(S)-3-Amino-3-(3-nitrophenyl)propionic acidPurity:98%Color and Shape:LiquidMolecular weight:210.19g/mol(S)-β-(3-Nitrophenyl)alanine
CAS:Formula:C9H10N2O4Purity:96%Color and Shape:SolidMolecular weight:210.189



