CAS 734543-01-2

2-Chloro-N-(2-chloroacetyl)benzamide

Description:

2-Chloro-N-(2-chloroacetyl)benzamide is a chemical compound characterized by its structural features, which include a benzamide core substituted with two chloro groups and an acetyl moiety. The presence of the chloro groups enhances its reactivity and may influence its biological activity. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its aromatic nature. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the amide functional group, which is known for its ability to participate in hydrogen bonding and other interactions. The compound's reactivity can be attributed to the electrophilic nature of the chloro substituents, making it a candidate for further chemical transformations. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 2-Chloro-N-(2-chloroacetyl)benzamide represents a versatile compound with potential utility in various chemical applications.

Formula: C₉H₇Cl₂NO₂

InChI: InChI=1S/C9H7Cl2NO2/c10-5-8(13)12-9(14)6-3-1-2-4-7(6)11/h1-4H,5H2,(H,12,13,14)

InChI key: InChIKey=LXMGWCSUYICVQI-UHFFFAOYSA-N

SMILES: C(NC(CCl)=O)(=O)C1=C(Cl)C=CC=C1

Synonyms:

• Benzamide, 2-chloro-N-(chloroacetyl)-
• Benzamide, 2-chloro-N-(2-chloroacetyl)-
• 2-Chloro-N-(2-chloroacetyl)benzamide