CymitQuimica logo

CAS 734546-73-7

:

2-(4-Chlorophenoxy)-5-(1-piperidinylsulfonyl)benzenamine

Description:
2-(4-Chlorophenoxy)-5-(1-piperidinylsulfonyl)benzenamine, with the CAS number 734546-73-7, is a chemical compound characterized by its complex structure, which includes a chlorophenoxy group and a piperidinylsulfonyl moiety. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the chlorophenyl group may impart specific electronic and steric effects, influencing its reactivity and interaction with biological targets. The piperidine ring contributes to its basicity and may enhance its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the sulfonyl group can enhance the compound's solubility and bioavailability. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting various biological pathways. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation.
Formula:C17H19ClN2O3S
InChI:InChI=1S/C17H19ClN2O3S/c18-13-4-6-14(7-5-13)23-17-9-8-15(12-16(17)19)24(21,22)20-10-2-1-3-11-20/h4-9,12H,1-3,10-11,19H2
InChI key:InChIKey=QKFYVRLUWICUGC-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(N)=C(OC2=CC=C(Cl)C=C2)C=C1)N3CCCCC3
Synonyms:
  • 2-(4-Chlorophenoxy)-5-(1-piperidinylsulfonyl)benzenamine
  • Benzenamine, 2-(4-chlorophenoxy)-5-(1-piperidinylsulfonyl)-
  • Piperidine, 1-[[3-amino-4-(4-chlorophenoxy)phenyl]sulfonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.