CAS 7346-13-6
:Propanedioic acid, 2-oxo-, sodium salt (1:2)
Description:
Propanedioic acid, 2-oxo-, sodium salt (1:2), commonly known as sodium oxalate, is a sodium salt derived from oxalic acid. It appears as a white crystalline solid and is highly soluble in water, making it useful in various applications. This compound is characterized by its ability to act as a buffering agent and is often utilized in biochemical and analytical chemistry settings. It exhibits chelating properties, allowing it to bind metal ions, which can be beneficial in various chemical reactions and processes. Sodium oxalate is also known for its role in the synthesis of other organic compounds and can be used in the textile and dye industries. While it is generally considered to have low toxicity, it can be harmful in large quantities, particularly due to its potential to form insoluble complexes with calcium in biological systems. Proper handling and safety measures should be observed when working with this compound.
Formula:C3H2O5·2Na
InChI:InChI=1S/C3H2O5.2Na/c4-1(2(5)6)3(7)8;;/h(H,5,6)(H,7,8);;
InChI key:InChIKey=WHNMFMILRQBAEA-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C(O)=O)=O.[Na]
Synonyms:- Sodium oxomalonate
- Mesoxalic acid, disodium salt
- Propanedioic acid, oxo-, disodium salt
- Disodium ketomalonate
- Propanedioic acid, 2-oxo-, sodium salt (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
