CAS 73464-43-4
:D-Glutamic acid, 4-amino-, (4R)-rel-
Description:
D-Glutamic acid, 4-amino-, (4R)-rel- is an amino acid that is a stereoisomer of glutamic acid, characterized by its specific chiral configuration at the fourth carbon atom. It is a non-essential amino acid, meaning that it can be synthesized by the body. This compound plays a crucial role in various biological processes, including protein synthesis and neurotransmission. As a polar molecule, D-glutamic acid is soluble in water, which facilitates its biological functions. The presence of both carboxyl and amino groups allows it to participate in acid-base reactions, making it an important component in metabolic pathways. Its unique stereochemistry may influence its interaction with enzymes and receptors, potentially affecting its biological activity. D-Glutamic acid is also studied for its potential roles in neurobiology and its implications in various health conditions. Overall, this compound is significant in both biochemical research and potential therapeutic applications.
Formula:C5H10N2O4
InChI:InChI=1/C5H10N2O4/c6-2(4(8)9)1-3(7)5(10)11/h2-3H,1,6-7H2,(H,8,9)(H,10,11)/t2-,3-/s2
InChI key:InChIKey=LOPLXECQBMXEBQ-MZTXYVAJNA-N
SMILES:[C@H](C[C@@H](C(O)=O)N)(C(O)=O)N
Synonyms:- D-Glutamic acid, 4-amino-, (4R)-rel-
- DL-Glutamic acid, 4-amino-, threo-
- threo-2,4-Diaminopentanedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
