CAS 7347-19-5

2-(2,4,6-Tribromophenoxy)ethyl 2-propenoate

Description:

2-(2,4,6-Tribromophenoxy)ethyl 2-propenoate, with CAS number 7347-19-5, is an organic compound characterized by its unique structure, which includes a tribromophenyl group and an acrylate moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity due to the presence of the acrylate functional group, which can undergo polymerization and participate in various chemical reactions, making it useful in polymer chemistry and materials science. The tribromophenyl group contributes to its potential applications in flame retardancy and as a biocide, owing to the bromine atoms' ability to enhance the compound's stability and reactivity. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and varying degrees of thermal stability. Safety considerations are important, as the brominated compounds can pose environmental and health risks, necessitating careful handling and disposal.

Formula: C₁₁H₉Br₃O₃

InChI: InChI=1S/C11H9Br3O3/c1-2-10(15)16-3-4-17-11-8(13)5-7(12)6-9(11)14/h2,5-6H,1,3-4H2

InChI key: InChIKey=AMBJXYFIMKHOQE-UHFFFAOYSA-N

SMILES: O(CCOC(C=C)=O)C1=C(Br)C=C(Br)C=C1Br

Synonyms:

• 2-(2,4,6-Tribromophenoxy)ethyl 2-propenoate
• Acrylic acid, 2-(2,4,6-tribromophenoxy)ethyl ester
• GX 6099
• 2-Propenoic acid, 2-(2,4,6-tribromophenoxy)ethyl ester
• 2-(2,4,6-Tribromophenoxy)ethyl acrylate