CAS 73473-56-0
:cyclopenta[cd]pyren-4(3H)-one
Description:
Cyclopenta[cd]pyren-4(3H)-one is a polycyclic aromatic compound characterized by its fused ring structure, which includes a cyclopentane ring integrated with a pyrene framework. This compound typically exhibits a planar structure, contributing to its potential for strong π-π stacking interactions, which can influence its physical properties and reactivity. It is known for its fluorescence properties, making it of interest in various applications, including organic electronics and photonics. The presence of the ketone functional group at the 4-position introduces reactivity that can be exploited in synthetic chemistry. Additionally, cyclopenta[cd]pyren-4(3H)-one may exhibit hydrophobic characteristics due to its extensive aromatic system, affecting its solubility in different solvents. Its stability and behavior under various conditions can be influenced by factors such as temperature and the presence of other chemical species. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of materials science and environmental chemistry.
Formula:C18H10O
InChI:InChI=1/C18H10O/c19-15-9-13-7-6-11-5-4-10-2-1-3-12-8-14(15)17(13)18(11)16(10)12/h1-8H,9H2
SMILES:c1cc2ccc3ccc4CC(=O)c5cc(c1)c2c3c45
Synonyms:- Cyclopenta(cd)pyren-4(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyclopenta[cd]pyren-4(3H)-one
CAS:Controlled ProductFormula:C18H10OColor and Shape:NeatMolecular weight:242.271
