CAS 73496-29-4
:carbostyril 151
Description:
Carbostyril 151, identified by its CAS number 73496-29-4, is a chemical compound that belongs to the class of carbostyrils, which are derivatives of phenylpyridine. This compound is characterized by its unique structure, which typically includes a pyridine ring fused to a phenyl group. Carbostyril 151 is known for its application in various fields, including pharmaceuticals and materials science, due to its potential as a building block in organic synthesis. It exhibits properties such as moderate solubility in organic solvents and may possess specific optical or electronic characteristics, making it useful in the development of dyes or sensors. Additionally, its reactivity can be influenced by the presence of functional groups, allowing for further chemical modifications. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage in laboratory or industrial settings. Overall, carbostyril 151 is a versatile compound with applications that leverage its chemical properties.
Formula:C10H6F3NO2
InChI:InChI=1/C10H6F3NO2/c11-10(12,13)7-4-9(16)14-8-3-5(15)1-2-6(7)8/h1-4,15H,(H,14,16)
SMILES:c1cc2c(cc(nc2cc1O)O)C(F)(F)F
Synonyms:- 7-hydroxy-4-(trifluoromethyl)quinolin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.