CAS 73498-29-0

3-Chloro-1,2-benzisoxazol-5-amine

Description:

3-Chloro-1,2-benzisoxazol-5-amine is a chemical compound characterized by its unique structure, which includes a benzisoxazole ring system substituted with a chlorine atom and an amino group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions. The chlorine atom introduces electrophilic characteristics, making it a useful intermediate in organic synthesis. Additionally, compounds like 3-Chloro-1,2-benzisoxazol-5-amine may exhibit biological activity, potentially serving as a scaffold for drug development or as a tool in biochemical research. Its molecular structure suggests it could interact with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound represents a valuable entity in both synthetic and medicinal chemistry contexts.

Formula: C₇H₅ClN₂O

InChI: InChI=1S/C7H5ClN2O/c8-7-5-3-4(9)1-2-6(5)11-10-7/h1-3H,9H2

InChI key: InChIKey=HXSXBNGBEQTREL-UHFFFAOYSA-N

SMILES: ClC=1C=2C(=CC=C(N)C2)ON1

Synonyms:

• 3-Chloro-1,2-benzisoxazol-5-amine
• 3-Chloro-1,2-benzoxazol-5-amine
• 1,2-Benzisoxazol-5-amine, 3-chloro-
• 3-Chloro-benzo[d]isoxazol-5-ylamine